C11H13FN2O2 — CID 82391857
5-(2-aminoethyl)-3-(4-fluorophenyl)-1,3-oxazolidin-2-one (PubChem CID 82391857) has the molecular formula C11H13FN2O2 and a molecular weight of 224.24 g/mol. Its IUPAC name is 5-(2-aminoethyl)-3-(4-fluorophenyl)-1,3-oxazolidin-2-one.
| Compound Name | 5-(2-aminoethyl)-3-(4-fluorophenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 82391857 |
| Molecular Formula | C11H13FN2O2 |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 5-(2-aminoethyl)-3-(4-fluorophenyl)-1,3-oxazolidin-2-one |
| SMILES | NCCC1CN(c2ccc(F)cc2)C(=O)O1 |
| InChI | InChI=1S/C11H13FN2O2/c12-8-1-3-9(4-2-8)14-7-10(5-6-13)16-11(14)15/h1-4,10H,5-7,13H2 |
| InChIKey | OXYRXOQPPWEDDF-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |