C10H9BrFNO2 — CID 51000280
5-(bromomethyl)-3-(4-fluorophenyl)-1,3-oxazolidin-2-one (PubChem CID 51000280) has the molecular formula C10H9BrFNO2 and a molecular weight of 274.09 g/mol. Its IUPAC name is 5-(bromomethyl)-3-(4-fluorophenyl)-1,3-oxazolidin-2-one.
| Compound Name | 5-(bromomethyl)-3-(4-fluorophenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 51000280 |
| Molecular Formula | C10H9BrFNO2 |
| Molecular Weight | 274.09 g/mol |
| Exact Mass | 272.98 |
| IUPAC Name | 5-(bromomethyl)-3-(4-fluorophenyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1OC(CBr)CN1c1ccc(F)cc1 |
| InChI | InChI=1S/C10H9BrFNO2/c11-5-9-6-13(10(14)15-9)8-3-1-7(12)2-4-8/h1-4,9H,5-6H2 |
| InChIKey | XJKABTHXZUEAHA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.09 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|