C11H12FNO5S — CID 14368941
[3-(4-fluorophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate (PubChem CID 14368941) has the molecular formula C11H12FNO5S and a molecular weight of 289.28 g/mol. Its IUPAC name is [3-(4-fluorophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate.
| Compound Name | [3-(4-fluorophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 14368941 |
| Molecular Formula | C11H12FNO5S |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | [3-(4-fluorophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCC1CN(c2ccc(F)cc2)C(=O)O1 |
| InChI | InChI=1S/C11H12FNO5S/c1-19(15,16)17-7-10-6-13(11(14)18-10)9-4-2-8(12)3-5-9/h2-5,10H,6-7H2,1H3 |
| InChIKey | CFETZFKXUAYQDX-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|