C11H10F2INO5S — CID 25133625
[(5R)-3-(3,5-difluoro-4-iodophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate (PubChem CID 25133625) has the molecular formula C11H10F2INO5S and a molecular weight of 433.17 g/mol. Its IUPAC name is [(5R)-3-(3,5-difluoro-4-iodophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate.
| Compound Name | [(5R)-3-(3,5-difluoro-4-iodophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 25133625 |
| Molecular Formula | C11H10F2INO5S |
| Molecular Weight | 433.17 g/mol |
| Exact Mass | 432.93 |
| IUPAC Name | [(5R)-3-(3,5-difluoro-4-iodophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@H]1CN(c2cc(F)c(I)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C11H10F2INO5S/c1-21(17,18)19-5-7-4-15(11(16)20-7)6-2-8(12)10(14)9(13)3-6/h2-3,7H,4-5H2,1H3/t7-/m1/s1 |
| InChIKey | DFBIIEUFKAUVIS-SSDOTTSWSA-N |
| XLogP | 1.87 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.17 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|