C20H27FN2O7S — CID 59754043
[(5R)-3-[4-(6,6-dimethyl-1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate (PubChem CID 59754043) has the molecular formula C20H27FN2O7S and a molecular weight of 458.51 g/mol. Its IUPAC name is [(5R)-3-[4-(6,6-dimethyl-1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate.
| Compound Name | [(5R)-3-[4-(6,6-dimethyl-1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 59754043 |
| Molecular Formula | C20H27FN2O7S |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | [(5R)-3-[4-(6,6-dimethyl-1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate |
| SMILES | CC1(C)CN(c2ccc(N3C[C@H](COS(C)(=O)=O)OC3=O)cc2F)CCC12OCCO2 |
| InChI | InChI=1S/C20H27FN2O7S/c1-19(2)13-22(7-6-20(19)27-8-9-28-20)17-5-4-14(10-16(17)21)23-11-15(30-18(23)24)12-29-31(3,25)26/h4-5,10,15H,6-9,11-13H2,1-3H3/t15-/m1/s1 |
| InChIKey | JEEHENQLNQWZKD-OAHLLOKOSA-N |
| XLogP | 2.11 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|