C18H24FN3O7S — CID 18783918
[3-[3-fluoro-4-[4-(2-methoxyethyl)-3-oxopiperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate (PubChem CID 18783918) has the molecular formula C18H24FN3O7S and a molecular weight of 445.47 g/mol. Its IUPAC name is [3-[3-fluoro-4-[4-(2-methoxyethyl)-3-oxopiperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate.
| Compound Name | [3-[3-fluoro-4-[4-(2-methoxyethyl)-3-oxopiperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 18783918 |
| Molecular Formula | C18H24FN3O7S |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | [3-[3-fluoro-4-[4-(2-methoxyethyl)-3-oxopiperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate |
| SMILES | COCCN1CCN(c2ccc(N3CC(COS(C)(=O)=O)OC3=O)cc2F)CC1=O |
| InChI | InChI=1S/C18H24FN3O7S/c1-27-8-7-20-5-6-21(11-17(20)23)16-4-3-13(9-15(16)19)22-10-14(29-18(22)24)12-28-30(2,25)26/h3-4,9,14H,5-8,10-12H2,1-2H3 |
| InChIKey | OMFPYJXQRUFOIQ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 105.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|