C14H14FN3O5S — CID 10760653
[(5R)-3-(3-fluoro-4-imidazol-1-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate (PubChem CID 10760653) has the molecular formula C14H14FN3O5S and a molecular weight of 355.35 g/mol. Its IUPAC name is [(5R)-3-(3-fluoro-4-imidazol-1-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate.
| Compound Name | [(5R)-3-(3-fluoro-4-imidazol-1-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 10760653 |
| Molecular Formula | C14H14FN3O5S |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | [(5R)-3-(3-fluoro-4-imidazol-1-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@H]1CN(c2ccc(-n3ccnc3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C14H14FN3O5S/c1-24(20,21)22-8-11-7-18(14(19)23-11)10-2-3-13(12(15)6-10)17-5-4-16-9-17/h2-6,9,11H,7-8H2,1H3/t11-/m1/s1 |
| InChIKey | UZXQGYREWAYBIZ-LLVKDONJSA-N |
| XLogP | 1.31 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|