C17H15FN4O5S — CID 11661419
[(5R)-3-[4-(benzotriazol-1-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate (PubChem CID 11661419) has the molecular formula C17H15FN4O5S and a molecular weight of 406.40 g/mol. Its IUPAC name is [(5R)-3-[4-(benzotriazol-1-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate.
| Compound Name | [(5R)-3-[4-(benzotriazol-1-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 11661419 |
| Molecular Formula | C17H15FN4O5S |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | [(5R)-3-[4-(benzotriazol-1-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@H]1CN(c2ccc(-n3nnc4ccccc43)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C17H15FN4O5S/c1-28(24,25)26-10-12-9-21(17(23)27-12)11-6-7-15(13(18)8-11)22-16-5-3-2-4-14(16)19-20-22/h2-8,12H,9-10H2,1H3/t12-/m1/s1 |
| InChIKey | QTCNSHMYSZOHRK-GFCCVEGCSA-N |
| XLogP | 1.86 |
| TPSA | 103.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|