C18H24F2N2O8S2 — CID 90160088
[(5R)-3-[3-fluoro-4-[4-fluoro-4-(methylsulfonyloxymethyl)piperidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate (PubChem CID 90160088) has the molecular formula C18H24F2N2O8S2 and a molecular weight of 498.53 g/mol. Its IUPAC name is [(5R)-3-[3-fluoro-4-[4-fluoro-4-(methylsulfonyloxymethyl)piperidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate.
| Compound Name | [(5R)-3-[3-fluoro-4-[4-fluoro-4-(methylsulfonyloxymethyl)piperidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 90160088 |
| Molecular Formula | C18H24F2N2O8S2 |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.09 |
| IUPAC Name | [(5R)-3-[3-fluoro-4-[4-fluoro-4-(methylsulfonyloxymethyl)piperidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@H]1CN(c2ccc(N3CCC(F)(COS(C)(=O)=O)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C18H24F2N2O8S2/c1-31(24,25)28-11-14-10-22(17(23)30-14)13-3-4-16(15(19)9-13)21-7-5-18(20,6-8-21)12-29-32(2,26)27/h3-4,9,14H,5-8,10-12H2,1-2H3/t14-/m1/s1 |
| InChIKey | DCKRPGFDCIFGDN-CQSZACIVSA-N |
| XLogP | 1.41 |
| TPSA | 119.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|