C20H28FN3O7S — CID 21462626
tert-butyl 4-[2-fluoro-4-[5-(methylsulfonyloxymethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]piperazine-1-carboxylate (PubChem CID 21462626) has the molecular formula C20H28FN3O7S and a molecular weight of 473.52 g/mol. Its IUPAC name is tert-butyl 4-[2-fluoro-4-[5-(methylsulfonyloxymethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-fluoro-4-[5-(methylsulfonyloxymethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 21462626 |
| Molecular Formula | C20H28FN3O7S |
| Molecular Weight | 473.52 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | tert-butyl 4-[2-fluoro-4-[5-(methylsulfonyloxymethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(N3CC(COS(C)(=O)=O)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C20H28FN3O7S/c1-20(2,3)31-18(25)23-9-7-22(8-10-23)17-6-5-14(11-16(17)21)24-12-15(30-19(24)26)13-29-32(4,27)28/h5-6,11,15H,7-10,12-13H2,1-4H3 |
| InChIKey | VZMWICSAQKEPBS-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 105.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.52 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|