C22H29Cl2FN4O5 — CID 143613151
2-methylbutan-2-yl 4-[4-[5-[[(2,2-dichloroacetyl)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazine-1-carboxylate (PubChem CID 143613151) has the molecular formula C22H29Cl2FN4O5 and a molecular weight of 519.40 g/mol. Its IUPAC name is 2-methylbutan-2-yl 4-[4-[5-[[(2,2-dichloroacetyl)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazine-1-carboxylate.
| Compound Name | 2-methylbutan-2-yl 4-[4-[5-[[(2,2-dichloroacetyl)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 143613151 |
| Molecular Formula | C22H29Cl2FN4O5 |
| Molecular Weight | 519.40 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | 2-methylbutan-2-yl 4-[4-[5-[[(2,2-dichloroacetyl)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazine-1-carboxylate |
| SMILES | CCC(C)(C)OC(=O)N1CCN(c2ccc(N3CC(CNC(=O)C(Cl)Cl)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C22H29Cl2FN4O5/c1-4-22(2,3)34-20(31)28-9-7-27(8-10-28)17-6-5-14(11-16(17)25)29-13-15(33-21(29)32)12-26-19(30)18(23)24/h5-6,11,15,18H,4,7-10,12-13H2,1-3H3,(H,26,30) |
| InChIKey | YSTCTCFCJCSDQT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|