C24H27FN4O5 — CID 67054838
benzyl 4-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazine-1-carboxylate (PubChem CID 67054838) has the molecular formula C24H27FN4O5 and a molecular weight of 470.50 g/mol. Its IUPAC name is benzyl 4-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazine-1-carboxylate.
| Compound Name | benzyl 4-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 67054838 |
| Molecular Formula | C24H27FN4O5 |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | benzyl 4-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazine-1-carboxylate |
| SMILES | CC(=O)NCC1CN(c2ccc(N3CCN(C(=O)OCc4ccccc4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C24H27FN4O5/c1-17(30)26-14-20-15-29(24(32)34-20)19-7-8-22(21(25)13-19)27-9-11-28(12-10-27)23(31)33-16-18-5-3-2-4-6-18/h2-8,13,20H,9-12,14-16H2,1H3,(H,26,30) |
| InChIKey | CTQLUMJVOCQEBM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|