C25H29FN4O5 — CID 70195606
N-[1-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]pyrrolidin-3-yl]-2-phenylmethoxyacetamide (PubChem CID 70195606) has the molecular formula C25H29FN4O5 and a molecular weight of 484.53 g/mol. Its IUPAC name is N-[1-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]pyrrolidin-3-yl]-2-phenylmethoxyacetamide.
| Compound Name | N-[1-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]pyrrolidin-3-yl]-2-phenylmethoxyacetamide |
|---|---|
| PubChem CID | 70195606 |
| Molecular Formula | C25H29FN4O5 |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | N-[1-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]pyrrolidin-3-yl]-2-phenylmethoxyacetamide |
| SMILES | CC(=O)NCC1CN(c2ccc(N3CCC(NC(=O)COCc4ccccc4)C3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C25H29FN4O5/c1-17(31)27-12-21-14-30(25(33)35-21)20-7-8-23(22(26)11-20)29-10-9-19(13-29)28-24(32)16-34-15-18-5-3-2-4-6-18/h2-8,11,19,21H,9-10,12-16H2,1H3,(H,27,31)(H,28,32) |
| InChIKey | LIHOLEQEAIFLCI-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|