C17H22FN3O5 — CID 59994592
N-[[(5S)-3-[4-[(3S,4R)-3,4-dihydroxypiperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 59994592) has the molecular formula C17H22FN3O5 and a molecular weight of 367.38 g/mol. Its IUPAC name is N-[[(5S)-3-[4-[(3S,4R)-3,4-dihydroxypiperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-[4-[(3S,4R)-3,4-dihydroxypiperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 59994592 |
| Molecular Formula | C17H22FN3O5 |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | N-[[(5S)-3-[4-[(3S,4R)-3,4-dihydroxypiperidin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(N3CC[C@@H](O)[C@@H](O)C3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C17H22FN3O5/c1-10(22)19-7-12-8-21(17(25)26-12)11-2-3-14(13(18)6-11)20-5-4-15(23)16(24)9-20/h2-3,6,12,15-16,23-24H,4-5,7-9H2,1H3,(H,19,22)/t12-,15+,16-/m0/s1 |
| InChIKey | HRLLRPBMPIUEIV-MAZHCROVSA-N |
| XLogP | 0.22 |
| TPSA | 102.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|