C17H20FN3O3 — CID 142224217
N-[[3-[4-[(5R)-3-azabicyclo[3.1.0]hexan-3-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 142224217) has the molecular formula C17H20FN3O3 and a molecular weight of 333.36 g/mol. Its IUPAC name is N-[[3-[4-[(5R)-3-azabicyclo[3.1.0]hexan-3-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[3-[4-[(5R)-3-azabicyclo[3.1.0]hexan-3-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 142224217 |
| Molecular Formula | C17H20FN3O3 |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | N-[[3-[4-[(5R)-3-azabicyclo[3.1.0]hexan-3-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CN(c2ccc(N3CC4C[C@H]4C3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C17H20FN3O3/c1-10(22)19-6-14-9-21(17(23)24-14)13-2-3-16(15(18)5-13)20-7-11-4-12(11)8-20/h2-3,5,11-12,14H,4,6-9H2,1H3,(H,19,22)/t11-,12?,14?/m0/s1 |
| InChIKey | OONSKQALMXTOGJ-DCBWTQNWSA-N |
| XLogP | 1.74 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|