C21H26FN3O4 — CID 70201549
N-[[3-[3-fluoro-4-(5-oxo-1,3,4,4a,6,7,8,8a-octahydroisoquinolin-2-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 70201549) has the molecular formula C21H26FN3O4 and a molecular weight of 403.45 g/mol. Its IUPAC name is N-[[3-[3-fluoro-4-(5-oxo-1,3,4,4a,6,7,8,8a-octahydroisoquinolin-2-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[3-[3-fluoro-4-(5-oxo-1,3,4,4a,6,7,8,8a-octahydroisoquinolin-2-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 70201549 |
| Molecular Formula | C21H26FN3O4 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | N-[[3-[3-fluoro-4-(5-oxo-1,3,4,4a,6,7,8,8a-octahydroisoquinolin-2-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CN(c2ccc(N3CCC4C(=O)CCCC4C3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C21H26FN3O4/c1-13(26)23-10-16-12-25(21(28)29-16)15-5-6-19(18(22)9-15)24-8-7-17-14(11-24)3-2-4-20(17)27/h5-6,9,14,16-17H,2-4,7-8,10-12H2,1H3,(H,23,26) |
| InChIKey | KLGSPZPOXRFFRF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|