C24H28FN5O5 — CID 73056507
4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-6-hydroxy-N-phenyl-1,4-diazepane-1-carboxamide (PubChem CID 73056507) has the molecular formula C24H28FN5O5 and a molecular weight of 485.52 g/mol. Its IUPAC name is 4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-6-hydroxy-N-phenyl-1,4-diazepane-1-carboxamide.
| Compound Name | 4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-6-hydroxy-N-phenyl-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 73056507 |
| Molecular Formula | C24H28FN5O5 |
| Molecular Weight | 485.52 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | 4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-6-hydroxy-N-phenyl-1,4-diazepane-1-carboxamide |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(N3CCN(C(=O)Nc4ccccc4)CC(O)C3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C24H28FN5O5/c1-16(31)26-12-20-15-30(24(34)35-20)18-7-8-22(21(25)11-18)28-9-10-29(14-19(32)13-28)23(33)27-17-5-3-2-4-6-17/h2-8,11,19-20,32H,9-10,12-15H2,1H3,(H,26,31)(H,27,33)/t19?,20-/m0/s1 |
| InChIKey | SFURSXNUGRLQJK-ANYOKISRSA-N |
| XLogP | 2.00 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.52 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|