C23H25FN6O5S — CID 11756281
4-[4-[(5S)-5-[(ethanethioylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-N-(4-nitrophenyl)piperazine-1-carboxamide (PubChem CID 11756281) has the molecular formula C23H25FN6O5S and a molecular weight of 516.56 g/mol. Its IUPAC name is 4-[4-[(5S)-5-[(ethanethioylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-N-(4-nitrophenyl)piperazine-1-carboxamide.
| Compound Name | 4-[4-[(5S)-5-[(ethanethioylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-N-(4-nitrophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 11756281 |
| Molecular Formula | C23H25FN6O5S |
| Molecular Weight | 516.56 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | 4-[4-[(5S)-5-[(ethanethioylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-N-(4-nitrophenyl)piperazine-1-carboxamide |
| SMILES | CC(=S)NC[C@H]1CN(c2ccc(N3CCN(C(=O)Nc4ccc([N+](=O)[O-])cc4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C23H25FN6O5S/c1-15(36)25-13-19-14-29(23(32)35-19)18-6-7-21(20(24)12-18)27-8-10-28(11-9-27)22(31)26-16-2-4-17(5-3-16)30(33)34/h2-7,12,19H,8-11,13-14H2,1H3,(H,25,36)(H,26,31)/t19-/m0/s1 |
| InChIKey | XDXSWBODORUJPA-IBGZPJMESA-N |
| XLogP | 3.35 |
| TPSA | 120.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.56 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|