C18H24FN5O3S2 — CID 87832819
N-[[3-[4-[4-(2-aminosulfanylacetyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide (PubChem CID 87832819) has the molecular formula C18H24FN5O3S2 and a molecular weight of 441.55 g/mol. Its IUPAC name is N-[[3-[4-[4-(2-aminosulfanylacetyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide.
| Compound Name | N-[[3-[4-[4-(2-aminosulfanylacetyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
|---|---|
| PubChem CID | 87832819 |
| Molecular Formula | C18H24FN5O3S2 |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | N-[[3-[4-[4-(2-aminosulfanylacetyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
| SMILES | CC(=S)NCC1CN(c2ccc(N3CCN(C(=O)CSN)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C18H24FN5O3S2/c1-12(28)21-9-14-10-24(18(26)27-14)13-2-3-16(15(19)8-13)22-4-6-23(7-5-22)17(25)11-29-20/h2-3,8,14H,4-7,9-11,20H2,1H3,(H,21,28) |
| InChIKey | WNGCLGHKPFLXEF-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|