C21H29FN4O4S — CID 18619374
N-[[3-[3-fluoro-4-[4-(2-hydroxyacetyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-3-methylbutanethioamide (PubChem CID 18619374) has the molecular formula C21H29FN4O4S and a molecular weight of 452.55 g/mol. Its IUPAC name is N-[[3-[3-fluoro-4-[4-(2-hydroxyacetyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-3-methylbutanethioamide.
| Compound Name | N-[[3-[3-fluoro-4-[4-(2-hydroxyacetyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-3-methylbutanethioamide |
|---|---|
| PubChem CID | 18619374 |
| Molecular Formula | C21H29FN4O4S |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | N-[[3-[3-fluoro-4-[4-(2-hydroxyacetyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-3-methylbutanethioamide |
| SMILES | CC(C)CC(=S)NCC1CN(c2ccc(N3CCN(C(=O)CO)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C21H29FN4O4S/c1-14(2)9-19(31)23-11-16-12-26(21(29)30-16)15-3-4-18(17(22)10-15)24-5-7-25(8-6-24)20(28)13-27/h3-4,10,14,16,27H,5-9,11-13H2,1-2H3,(H,23,31) |
| InChIKey | HTGZJFMENHHVFO-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|