C19H25FN4O2S2 — CID 10180722
N-[[(5S)-3-[4-(4-ethanethioylpiperazin-1-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]propanethioamide (PubChem CID 10180722) has the molecular formula C19H25FN4O2S2 and a molecular weight of 424.57 g/mol. Its IUPAC name is N-[[(5S)-3-[4-(4-ethanethioylpiperazin-1-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]propanethioamide.
| Compound Name | N-[[(5S)-3-[4-(4-ethanethioylpiperazin-1-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]propanethioamide |
|---|---|
| PubChem CID | 10180722 |
| Molecular Formula | C19H25FN4O2S2 |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | N-[[(5S)-3-[4-(4-ethanethioylpiperazin-1-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]propanethioamide |
| SMILES | CCC(=S)NC[C@H]1CN(c2ccc(N3CCN(C(C)=S)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C19H25FN4O2S2/c1-3-18(28)21-11-15-12-24(19(25)26-15)14-4-5-17(16(20)10-14)23-8-6-22(7-9-23)13(2)27/h4-5,10,15H,3,6-9,11-12H2,1-2H3,(H,21,28)/t15-/m0/s1 |
| InChIKey | AXQIJOJSYOISFY-HNNXBMFYSA-N |
| XLogP | 2.95 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|