C20H25FN4O2S2 — CID 10388325
N-[[(5S)-3-[4-[4-(cyclopropanecarbothioyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide (PubChem CID 10388325) has the molecular formula C20H25FN4O2S2 and a molecular weight of 436.58 g/mol. Its IUPAC name is N-[[(5S)-3-[4-[4-(cyclopropanecarbothioyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide.
| Compound Name | N-[[(5S)-3-[4-[4-(cyclopropanecarbothioyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
|---|---|
| PubChem CID | 10388325 |
| Molecular Formula | C20H25FN4O2S2 |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | N-[[(5S)-3-[4-[4-(cyclopropanecarbothioyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
| SMILES | CC(=S)NC[C@H]1CN(c2ccc(N3CCN(C(=S)C4CC4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C20H25FN4O2S2/c1-13(28)22-11-16-12-25(20(26)27-16)15-4-5-18(17(21)10-15)23-6-8-24(9-7-23)19(29)14-2-3-14/h4-5,10,14,16H,2-3,6-9,11-12H2,1H3,(H,22,28)/t16-/m0/s1 |
| InChIKey | QAZUEUDRAFWGNT-INIZCTEOSA-N |
| XLogP | 2.95 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|