C20H22FN5O3S2 — CID 87833126
N-[[3-[3-fluoro-4-[4-(1,3-oxazole-5-carbothioyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide (PubChem CID 87833126) has the molecular formula C20H22FN5O3S2 and a molecular weight of 463.56 g/mol. Its IUPAC name is N-[[3-[3-fluoro-4-[4-(1,3-oxazole-5-carbothioyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide.
| Compound Name | N-[[3-[3-fluoro-4-[4-(1,3-oxazole-5-carbothioyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
|---|---|
| PubChem CID | 87833126 |
| Molecular Formula | C20H22FN5O3S2 |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | N-[[3-[3-fluoro-4-[4-(1,3-oxazole-5-carbothioyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
| SMILES | CC(=S)NCC1CN(c2ccc(N3CCN(C(=S)c4cnco4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C20H22FN5O3S2/c1-13(30)23-9-15-11-26(20(27)29-15)14-2-3-17(16(21)8-14)24-4-6-25(7-5-24)19(31)18-10-22-12-28-18/h2-3,8,10,12,15H,4-7,9,11H2,1H3,(H,23,30) |
| InChIKey | VOKJNEYTLNIUQF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 74.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|