C18H24FN5O2S2 — CID 10049961
N-[[(5S)-3-[4-[4-(2-aminoethanethioyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide (PubChem CID 10049961) has the molecular formula C18H24FN5O2S2 and a molecular weight of 425.56 g/mol. Its IUPAC name is N-[[(5S)-3-[4-[4-(2-aminoethanethioyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide.
| Compound Name | N-[[(5S)-3-[4-[4-(2-aminoethanethioyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
|---|---|
| PubChem CID | 10049961 |
| Molecular Formula | C18H24FN5O2S2 |
| Molecular Weight | 425.56 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | N-[[(5S)-3-[4-[4-(2-aminoethanethioyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
| SMILES | CC(=S)NC[C@H]1CN(c2ccc(N3CCN(C(=S)CN)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C18H24FN5O2S2/c1-12(27)21-10-14-11-24(18(25)26-14)13-2-3-16(15(19)8-13)22-4-6-23(7-5-22)17(28)9-20/h2-3,8,14H,4-7,9-11,20H2,1H3,(H,21,27)/t14-/m0/s1 |
| InChIKey | WZRWIJABXVIXKI-AWEZNQCLSA-N |
| XLogP | 1.50 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.56 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|