C21H22BrFN4O2S3 — CID 87833738
N-[[3-[4-[4-(5-bromothiophene-2-carbothioyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide (PubChem CID 87833738) has the molecular formula C21H22BrFN4O2S3 and a molecular weight of 557.54 g/mol. Its IUPAC name is N-[[3-[4-[4-(5-bromothiophene-2-carbothioyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide.
| Compound Name | N-[[3-[4-[4-(5-bromothiophene-2-carbothioyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
|---|---|
| PubChem CID | 87833738 |
| Molecular Formula | C21H22BrFN4O2S3 |
| Molecular Weight | 557.54 g/mol |
| Exact Mass | 556.01 |
| IUPAC Name | N-[[3-[4-[4-(5-bromothiophene-2-carbothioyl)piperazin-1-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
| SMILES | CC(=S)NCC1CN(c2ccc(N3CCN(C(=S)c4ccc(Br)s4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C21H22BrFN4O2S3/c1-13(30)24-11-15-12-27(21(28)29-15)14-2-3-17(16(23)10-14)25-6-8-26(9-7-25)20(31)18-4-5-19(22)32-18/h2-5,10,15H,6-9,11-12H2,1H3,(H,24,30) |
| InChIKey | XISVAHCRLFTPSL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.54 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|