C21H23FN4O2S3 — CID 85041610
N-[[3-[3-fluoro-4-[4-(thiophene-2-carbothioyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide (PubChem CID 85041610) has the molecular formula C21H23FN4O2S3 and a molecular weight of 478.64 g/mol. Its IUPAC name is N-[[3-[3-fluoro-4-[4-(thiophene-2-carbothioyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide.
| Compound Name | N-[[3-[3-fluoro-4-[4-(thiophene-2-carbothioyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
|---|---|
| PubChem CID | 85041610 |
| Molecular Formula | C21H23FN4O2S3 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | N-[[3-[3-fluoro-4-[4-(thiophene-2-carbothioyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
| SMILES | CC(=S)NCC1CN(c2ccc(N3CCN(C(=S)c4cccs4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C21H23FN4O2S3/c1-14(29)23-12-16-13-26(21(27)28-16)15-4-5-18(17(22)11-15)24-6-8-25(9-7-24)20(30)19-3-2-10-31-19/h2-5,10-11,16H,6-9,12-13H2,1H3,(H,23,29) |
| InChIKey | ICOAHHJRCQCFOL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|