C21H29FN4O3S — CID 22140937
N-[[3-[4-(4-acetylpiperazin-1-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-3-methylbutanethioamide (PubChem CID 22140937) has the molecular formula C21H29FN4O3S and a molecular weight of 436.55 g/mol. Its IUPAC name is N-[[3-[4-(4-acetylpiperazin-1-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-3-methylbutanethioamide.
| Compound Name | N-[[3-[4-(4-acetylpiperazin-1-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-3-methylbutanethioamide |
|---|---|
| PubChem CID | 22140937 |
| Molecular Formula | C21H29FN4O3S |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | N-[[3-[4-(4-acetylpiperazin-1-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-3-methylbutanethioamide |
| SMILES | CC(=O)N1CCN(c2ccc(N3CC(CNC(=S)CC(C)C)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C21H29FN4O3S/c1-14(2)10-20(30)23-12-17-13-26(21(28)29-17)16-4-5-19(18(22)11-16)25-8-6-24(7-9-25)15(3)27/h4-5,11,14,17H,6-10,12-13H2,1-3H3,(H,23,30) |
| InChIKey | JHYNBBNENQRFQI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|