C18H21Cl2FN4O4S — CID 89305750
O-methyl 4-[4-[5-[[(2,2-dichloroacetyl)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazine-1-carbothioate (PubChem CID 89305750) has the molecular formula C18H21Cl2FN4O4S and a molecular weight of 479.36 g/mol. Its IUPAC name is O-methyl 4-[4-[5-[[(2,2-dichloroacetyl)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazine-1-carbothioate.
| Compound Name | O-methyl 4-[4-[5-[[(2,2-dichloroacetyl)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazine-1-carbothioate |
|---|---|
| PubChem CID | 89305750 |
| Molecular Formula | C18H21Cl2FN4O4S |
| Molecular Weight | 479.36 g/mol |
| Exact Mass | 478.06 |
| IUPAC Name | O-methyl 4-[4-[5-[[(2,2-dichloroacetyl)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazine-1-carbothioate |
| SMILES | COC(=S)N1CCN(c2ccc(N3CC(CNC(=O)C(Cl)Cl)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C18H21Cl2FN4O4S/c1-28-18(30)24-6-4-23(5-7-24)14-3-2-11(8-13(14)21)25-10-12(29-17(25)27)9-22-16(26)15(19)20/h2-3,8,12,15H,4-7,9-10H2,1H3,(H,22,26) |
| InChIKey | YVMDFEZCDQXTQL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|