C20H28FN5O4 — CID 143999520
3-[3-fluoro-4-[4-[2-(methylamino)acetyl]piperazin-1-yl]phenyl]-5-[(1-methoxyethenylamino)methyl]-1,3-oxazolidin-2-one (PubChem CID 143999520) has the molecular formula C20H28FN5O4 and a molecular weight of 421.47 g/mol. Its IUPAC name is 3-[3-fluoro-4-[4-[2-(methylamino)acetyl]piperazin-1-yl]phenyl]-5-[(1-methoxyethenylamino)methyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[3-fluoro-4-[4-[2-(methylamino)acetyl]piperazin-1-yl]phenyl]-5-[(1-methoxyethenylamino)methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 143999520 |
| Molecular Formula | C20H28FN5O4 |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 3-[3-fluoro-4-[4-[2-(methylamino)acetyl]piperazin-1-yl]phenyl]-5-[(1-methoxyethenylamino)methyl]-1,3-oxazolidin-2-one |
| SMILES | C=C(NCC1CN(c2ccc(N3CCN(C(=O)CNC)CC3)c(F)c2)C(=O)O1)OC |
| InChI | InChI=1S/C20H28FN5O4/c1-14(29-3)23-11-16-13-26(20(28)30-16)15-4-5-18(17(21)10-15)24-6-8-25(9-7-24)19(27)12-22-2/h4-5,10,16,22-23H,1,6-9,11-13H2,2-3H3 |
| InChIKey | WWAOYRCBBCRJGF-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|