C23H31FN6O6S — CID 126540183
2-acetamido-N-[2-[4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]-2-oxoethyl]-3-sulfanylpropanamide (PubChem CID 126540183) has the molecular formula C23H31FN6O6S and a molecular weight of 538.60 g/mol. Its IUPAC name is 2-acetamido-N-[2-[4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]-2-oxoethyl]-3-sulfanylpropanamide.
| Compound Name | 2-acetamido-N-[2-[4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]-2-oxoethyl]-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 126540183 |
| Molecular Formula | C23H31FN6O6S |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | 2-acetamido-N-[2-[4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]-2-oxoethyl]-3-sulfanylpropanamide |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(N3CCN(C(=O)CNC(=O)C(CS)NC(C)=O)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C23H31FN6O6S/c1-14(31)25-10-17-12-30(23(35)36-17)16-3-4-20(18(24)9-16)28-5-7-29(8-6-28)21(33)11-26-22(34)19(13-37)27-15(2)32/h3-4,9,17,19,37H,5-8,10-13H2,1-2H3,(H,25,31)(H,26,34)(H,27,32)/t17-,19?/m0/s1 |
| InChIKey | FTFPXLZZSHNSPM-KKFHFHRHSA-N |
| XLogP | -0.51 |
| TPSA | 140.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|