C24H32FN5O6S — CID 157354978
2-acetamido-N-[2-[4-[2-fluoro-4-[(5S)-2-oxo-5-(3-oxobutyl)-1,3-oxazolidin-3-yl]phenyl]piperazin-1-yl]-2-oxoethyl]-3-sulfanylpropanamide (PubChem CID 157354978) has the molecular formula C24H32FN5O6S and a molecular weight of 537.61 g/mol. Its IUPAC name is 2-acetamido-N-[2-[4-[2-fluoro-4-[(5S)-2-oxo-5-(3-oxobutyl)-1,3-oxazolidin-3-yl]phenyl]piperazin-1-yl]-2-oxoethyl]-3-sulfanylpropanamide.
| Compound Name | 2-acetamido-N-[2-[4-[2-fluoro-4-[(5S)-2-oxo-5-(3-oxobutyl)-1,3-oxazolidin-3-yl]phenyl]piperazin-1-yl]-2-oxoethyl]-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 157354978 |
| Molecular Formula | C24H32FN5O6S |
| Molecular Weight | 537.61 g/mol |
| Exact Mass | 537.21 |
| IUPAC Name | 2-acetamido-N-[2-[4-[2-fluoro-4-[(5S)-2-oxo-5-(3-oxobutyl)-1,3-oxazolidin-3-yl]phenyl]piperazin-1-yl]-2-oxoethyl]-3-sulfanylpropanamide |
| SMILES | CC(=O)CC[C@H]1CN(c2ccc(N3CCN(C(=O)CNC(=O)C(CS)NC(C)=O)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C24H32FN5O6S/c1-15(31)3-5-18-13-30(24(35)36-18)17-4-6-21(19(25)11-17)28-7-9-29(10-8-28)22(33)12-26-23(34)20(14-37)27-16(2)32/h4,6,11,18,20,37H,3,5,7-10,12-14H2,1-2H3,(H,26,34)(H,27,32)/t18-,20?/m0/s1 |
| InChIKey | COAMMSQKJZXVGU-LROBGIAVSA-N |
| XLogP | 0.72 |
| TPSA | 128.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.61 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|