C19H25FN4O3S — CID 161486839
(5S)-3-[4-(1-ethanethioyl-1,2,5-triazepan-5-yl)-3-fluorophenyl]-5-(3-oxobutyl)-1,3-oxazolidin-2-one (PubChem CID 161486839) has the molecular formula C19H25FN4O3S and a molecular weight of 408.50 g/mol. Its IUPAC name is (5S)-3-[4-(1-ethanethioyl-1,2,5-triazepan-5-yl)-3-fluorophenyl]-5-(3-oxobutyl)-1,3-oxazolidin-2-one.
| Compound Name | (5S)-3-[4-(1-ethanethioyl-1,2,5-triazepan-5-yl)-3-fluorophenyl]-5-(3-oxobutyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 161486839 |
| Molecular Formula | C19H25FN4O3S |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | (5S)-3-[4-(1-ethanethioyl-1,2,5-triazepan-5-yl)-3-fluorophenyl]-5-(3-oxobutyl)-1,3-oxazolidin-2-one |
| SMILES | CC(=O)CC[C@H]1CN(c2ccc(N3CCNN(C(C)=S)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C19H25FN4O3S/c1-13(25)3-5-16-12-23(19(26)27-16)15-4-6-18(17(20)11-15)22-8-7-21-24(10-9-22)14(2)28/h4,6,11,16,21H,3,5,7-10,12H2,1-2H3/t16-/m0/s1 |
| InChIKey | WFBSAEIHFHTEPY-INIZCTEOSA-N |
| XLogP | 2.49 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|