C23H25FN4O4S — CID 148672305
(5S)-3-[3-fluoro-4-[2-(pyridine-4-carbothioyl)-1,2,5-oxadiazepan-5-yl]phenyl]-5-(3-oxobutyl)-1,3-oxazolidin-2-one (PubChem CID 148672305) has the molecular formula C23H25FN4O4S and a molecular weight of 472.54 g/mol. Its IUPAC name is (5S)-3-[3-fluoro-4-[2-(pyridine-4-carbothioyl)-1,2,5-oxadiazepan-5-yl]phenyl]-5-(3-oxobutyl)-1,3-oxazolidin-2-one.
| Compound Name | (5S)-3-[3-fluoro-4-[2-(pyridine-4-carbothioyl)-1,2,5-oxadiazepan-5-yl]phenyl]-5-(3-oxobutyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 148672305 |
| Molecular Formula | C23H25FN4O4S |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | (5S)-3-[3-fluoro-4-[2-(pyridine-4-carbothioyl)-1,2,5-oxadiazepan-5-yl]phenyl]-5-(3-oxobutyl)-1,3-oxazolidin-2-one |
| SMILES | CC(=O)CC[C@H]1CN(c2ccc(N3CCON(C(=S)c4ccncc4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C23H25FN4O4S/c1-16(29)2-4-19-15-27(23(30)32-19)18-3-5-21(20(24)14-18)26-10-11-28(31-13-12-26)22(33)17-6-8-25-9-7-17/h3,5-9,14,19H,2,4,10-13,15H2,1H3/t19-/m0/s1 |
| InChIKey | NPYQILBKAQGWJG-IBGZPJMESA-N |
| XLogP | 3.34 |
| TPSA | 75.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|