C25H28FN3O5 — CID 159204149
(5S)-3-[3-fluoro-4-(2-phenacyl-1,2,5-oxadiazepan-5-yl)phenyl]-5-(3-oxobutyl)-1,3-oxazolidin-2-one (PubChem CID 159204149) has the molecular formula C25H28FN3O5 and a molecular weight of 469.51 g/mol. Its IUPAC name is (5S)-3-[3-fluoro-4-(2-phenacyl-1,2,5-oxadiazepan-5-yl)phenyl]-5-(3-oxobutyl)-1,3-oxazolidin-2-one.
| Compound Name | (5S)-3-[3-fluoro-4-(2-phenacyl-1,2,5-oxadiazepan-5-yl)phenyl]-5-(3-oxobutyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 159204149 |
| Molecular Formula | C25H28FN3O5 |
| Molecular Weight | 469.51 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | (5S)-3-[3-fluoro-4-(2-phenacyl-1,2,5-oxadiazepan-5-yl)phenyl]-5-(3-oxobutyl)-1,3-oxazolidin-2-one |
| SMILES | CC(=O)CC[C@H]1CN(c2ccc(N3CCON(CC(=O)c4ccccc4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C25H28FN3O5/c1-18(30)7-9-21-16-29(25(32)34-21)20-8-10-23(22(26)15-20)27-11-12-28(33-14-13-27)17-24(31)19-5-3-2-4-6-19/h2-6,8,10,15,21H,7,9,11-14,16-17H2,1H3/t21-/m0/s1 |
| InChIKey | KPQUOWPIALSGOX-NRFANRHFSA-N |
| XLogP | 3.46 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.51 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|