C22H25FN4O3 — CID 175036032
3-[3-[3-fluoro-4-(4-phenylpiperazin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]propanamide (PubChem CID 175036032) has the molecular formula C22H25FN4O3 and a molecular weight of 412.47 g/mol. Its IUPAC name is 3-[3-[3-fluoro-4-(4-phenylpiperazin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]propanamide.
| Compound Name | 3-[3-[3-fluoro-4-(4-phenylpiperazin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]propanamide |
|---|---|
| PubChem CID | 175036032 |
| Molecular Formula | C22H25FN4O3 |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 3-[3-[3-fluoro-4-(4-phenylpiperazin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]propanamide |
| SMILES | NC(=O)CCC1CN(c2ccc(N3CCN(c4ccccc4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C22H25FN4O3/c23-19-14-17(27-15-18(30-22(27)29)7-9-21(24)28)6-8-20(19)26-12-10-25(11-13-26)16-4-2-1-3-5-16/h1-6,8,14,18H,7,9-13,15H2,(H2,24,28) |
| InChIKey | URRAILUBAWQRRR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|