C25H29FN4O5 — CID 91512763
3-[3-[3-fluoro-4-[4-(2-phenylmethoxyacetyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]propanamide (PubChem CID 91512763) has the molecular formula C25H29FN4O5 and a molecular weight of 484.53 g/mol. Its IUPAC name is 3-[3-[3-fluoro-4-[4-(2-phenylmethoxyacetyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]propanamide.
| Compound Name | 3-[3-[3-fluoro-4-[4-(2-phenylmethoxyacetyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]propanamide |
|---|---|
| PubChem CID | 91512763 |
| Molecular Formula | C25H29FN4O5 |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 3-[3-[3-fluoro-4-[4-(2-phenylmethoxyacetyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]propanamide |
| SMILES | NC(=O)CCC1CN(c2ccc(N3CCN(C(=O)COCc4ccccc4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C25H29FN4O5/c26-21-14-19(30-15-20(35-25(30)33)7-9-23(27)31)6-8-22(21)28-10-12-29(13-11-28)24(32)17-34-16-18-4-2-1-3-5-18/h1-6,8,14,20H,7,9-13,15-17H2,(H2,27,31) |
| InChIKey | UVDWDAPWNJALIE-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 105.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|