C17H23FN4O4S — CID 59975096
5-(aminomethyl)-3-[3-fluoro-4-[4-(2-methylsulfinylacetyl)piperazin-1-yl]phenyl]-1,3-oxazolidin-2-one (PubChem CID 59975096) has the molecular formula C17H23FN4O4S and a molecular weight of 398.46 g/mol. Its IUPAC name is 5-(aminomethyl)-3-[3-fluoro-4-[4-(2-methylsulfinylacetyl)piperazin-1-yl]phenyl]-1,3-oxazolidin-2-one.
| Compound Name | 5-(aminomethyl)-3-[3-fluoro-4-[4-(2-methylsulfinylacetyl)piperazin-1-yl]phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 59975096 |
| Molecular Formula | C17H23FN4O4S |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 5-(aminomethyl)-3-[3-fluoro-4-[4-(2-methylsulfinylacetyl)piperazin-1-yl]phenyl]-1,3-oxazolidin-2-one |
| SMILES | CS(=O)CC(=O)N1CCN(c2ccc(N3CC(CN)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C17H23FN4O4S/c1-27(25)11-16(23)21-6-4-20(5-7-21)15-3-2-12(8-14(15)18)22-10-13(9-19)26-17(22)24/h2-3,8,13H,4-7,9-11,19H2,1H3 |
| InChIKey | RDXNXIJXMATKHH-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|