C17H24FN4O4S+ — CID 59108844
2-[[4-[4-[(5S)-5-(aminomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-ium-1-ylidene]-methyl-λ4-sulfanyl]acetic acid (PubChem CID 59108844) has the molecular formula C17H24FN4O4S+ and a molecular weight of 399.47 g/mol. Its IUPAC name is 2-[[4-[4-[(5S)-5-(aminomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-ium-1-ylidene]-methyl-λ4-sulfanyl]acetic acid.
| Compound Name | 2-[[4-[4-[(5S)-5-(aminomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-ium-1-ylidene]-methyl-λ4-sulfanyl]acetic acid |
|---|---|
| PubChem CID | 59108844 |
| Molecular Formula | C17H24FN4O4S+ |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 2-[[4-[4-[(5S)-5-(aminomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-ium-1-ylidene]-methyl-λ4-sulfanyl]acetic acid |
| SMILES | CS(CC(=O)O)=[N+]1CCN(c2ccc(N3C[C@H](CN)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C17H23FN4O4S/c1-27(11-16(23)24)21-6-4-20(5-7-21)15-3-2-12(8-14(15)18)22-10-13(9-19)26-17(22)25/h2-3,8,13H,4-7,9-11,19H2,1H3/p+1/t13-,27?/m0/s1 |
| InChIKey | HNVZUISMDLMIDE-NGXIVSIZSA-O |
| XLogP | 0.46 |
| TPSA | 99.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|