C14H19FN4O2 — CID 22509418
5-(aminomethyl)-3-(3-fluoro-4-piperazin-1-ylphenyl)-1,3-oxazolidin-2-one (PubChem CID 22509418) has the molecular formula C14H19FN4O2 and a molecular weight of 294.33 g/mol. Its IUPAC name is 5-(aminomethyl)-3-(3-fluoro-4-piperazin-1-ylphenyl)-1,3-oxazolidin-2-one.
| Compound Name | 5-(aminomethyl)-3-(3-fluoro-4-piperazin-1-ylphenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 22509418 |
| Molecular Formula | C14H19FN4O2 |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 5-(aminomethyl)-3-(3-fluoro-4-piperazin-1-ylphenyl)-1,3-oxazolidin-2-one |
| SMILES | NCC1CN(c2ccc(N3CCNCC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C14H19FN4O2/c15-12-7-10(19-9-11(8-16)21-14(19)20)1-2-13(12)18-5-3-17-4-6-18/h1-2,7,11,17H,3-6,8-9,16H2 |
| InChIKey | HXMUHVDMNLEZDX-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|