C21H23F2N5O3 — CID 70891568
(5S)-5-(aminomethyl)-3-[3-fluoro-4-[1-(2-fluorobenzoyl)-1,2,5-triazepan-5-yl]phenyl]-1,3-oxazolidin-2-one (PubChem CID 70891568) has the molecular formula C21H23F2N5O3 and a molecular weight of 431.44 g/mol. Its IUPAC name is (5S)-5-(aminomethyl)-3-[3-fluoro-4-[1-(2-fluorobenzoyl)-1,2,5-triazepan-5-yl]phenyl]-1,3-oxazolidin-2-one.
| Compound Name | (5S)-5-(aminomethyl)-3-[3-fluoro-4-[1-(2-fluorobenzoyl)-1,2,5-triazepan-5-yl]phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 70891568 |
| Molecular Formula | C21H23F2N5O3 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | (5S)-5-(aminomethyl)-3-[3-fluoro-4-[1-(2-fluorobenzoyl)-1,2,5-triazepan-5-yl]phenyl]-1,3-oxazolidin-2-one |
| SMILES | NC[C@H]1CN(c2ccc(N3CCNN(C(=O)c4ccccc4F)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C21H23F2N5O3/c22-17-4-2-1-3-16(17)20(29)28-10-9-26(8-7-25-28)19-6-5-14(11-18(19)23)27-13-15(12-24)31-21(27)30/h1-6,11,15,25H,7-10,12-13,24H2/t15-/m0/s1 |
| InChIKey | WMHBLJJKJYBUMH-HNNXBMFYSA-N |
| XLogP | 1.72 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|