C17H23FN6O4 — CID 163558720
5-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-1,2,5-triazepane-1-carboxamide (PubChem CID 163558720) has the molecular formula C17H23FN6O4 and a molecular weight of 394.41 g/mol. Its IUPAC name is 5-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-1,2,5-triazepane-1-carboxamide.
| Compound Name | 5-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-1,2,5-triazepane-1-carboxamide |
|---|---|
| PubChem CID | 163558720 |
| Molecular Formula | C17H23FN6O4 |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 5-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-1,2,5-triazepane-1-carboxamide |
| SMILES | CC(=O)NCC1CN(c2ccc(N3CCNN(C(N)=O)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C17H23FN6O4/c1-11(25)20-9-13-10-23(17(27)28-13)12-2-3-15(14(18)8-12)22-5-4-21-24(7-6-22)16(19)26/h2-3,8,13,21H,4-7,9-10H2,1H3,(H2,19,26)(H,20,25) |
| InChIKey | FPISXMXYHZZPOL-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|