C20H25F4N8O4S+ — CID 143551857
[1-[(Z)-N'-[5-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-1,2,5-triazepane-1-carbonyl]carbamimidoyl]sulfanyl-2,2,2-trifluoroethylidene]azanium (PubChem CID 143551857) has the molecular formula C20H25F4N8O4S+ and a molecular weight of 549.53 g/mol. Its IUPAC name is [1-[(Z)-N'-[5-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-1,2,5-triazepane-1-carbonyl]carbamimidoyl]sulfanyl-2,2,2-trifluoroethylidene]azanium.
| Compound Name | [1-[(Z)-N'-[5-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-1,2,5-triazepane-1-carbonyl]carbamimidoyl]sulfanyl-2,2,2-trifluoroethylidene]azanium |
|---|---|
| PubChem CID | 143551857 |
| Molecular Formula | C20H25F4N8O4S+ |
| Molecular Weight | 549.53 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | [1-[(Z)-N'-[5-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-1,2,5-triazepane-1-carbonyl]carbamimidoyl]sulfanyl-2,2,2-trifluoroethylidene]azanium |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(N3CCNN(C(=O)/N=C(/N)SC(=[NH2+])C(F)(F)F)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C20H24F4N8O4S/c1-11(33)27-9-13-10-31(19(35)36-13)12-2-3-15(14(21)8-12)30-5-4-28-32(7-6-30)18(34)29-17(26)37-16(25)20(22,23)24/h2-3,8,13,25,28H,4-7,9-10H2,1H3,(H,27,33)(H2,26,29,34)/p+1/t13-/m0/s1 |
| InChIKey | VXRNJUZXPUUHSD-ZDUSSCGKSA-O |
| XLogP | -0.20 |
| TPSA | 158.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.53 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|