C18H24FN5O4S — CID 25252719
N-[[(5S)-3-[3-fluoro-4-[1-(2-hydroxyacetyl)-1,2,5-triazepan-5-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide (PubChem CID 25252719) has the molecular formula C18H24FN5O4S and a molecular weight of 425.49 g/mol. Its IUPAC name is N-[[(5S)-3-[3-fluoro-4-[1-(2-hydroxyacetyl)-1,2,5-triazepan-5-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide.
| Compound Name | N-[[(5S)-3-[3-fluoro-4-[1-(2-hydroxyacetyl)-1,2,5-triazepan-5-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
|---|---|
| PubChem CID | 25252719 |
| Molecular Formula | C18H24FN5O4S |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | N-[[(5S)-3-[3-fluoro-4-[1-(2-hydroxyacetyl)-1,2,5-triazepan-5-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
| SMILES | CC(=S)NC[C@H]1CN(c2ccc(N3CCNN(C(=O)CO)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C18H24FN5O4S/c1-12(29)20-9-14-10-23(18(27)28-14)13-2-3-16(15(19)8-13)22-5-4-21-24(7-6-22)17(26)11-25/h2-3,8,14,21,25H,4-7,9-11H2,1H3,(H,20,29)/t14-/m0/s1 |
| InChIKey | QHGGGUPFYYVHJN-AWEZNQCLSA-N |
| XLogP | 0.23 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|