C25H36FN5O9S — CID 25252858
[2-[5-[2-fluoro-4-[(5S)-5-[(methoxycarbothioylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]-1,2,5-triazepan-1-yl]-2-oxoethyl] 2-[2-(2-methoxyethoxy)ethoxy]acetate (PubChem CID 25252858) has the molecular formula C25H36FN5O9S and a molecular weight of 601.65 g/mol. Its IUPAC name is [2-[5-[2-fluoro-4-[(5S)-5-[(methoxycarbothioylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]-1,2,5-triazepan-1-yl]-2-oxoethyl] 2-[2-(2-methoxyethoxy)ethoxy]acetate.
| Compound Name | [2-[5-[2-fluoro-4-[(5S)-5-[(methoxycarbothioylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]-1,2,5-triazepan-1-yl]-2-oxoethyl] 2-[2-(2-methoxyethoxy)ethoxy]acetate |
|---|---|
| PubChem CID | 25252858 |
| Molecular Formula | C25H36FN5O9S |
| Molecular Weight | 601.65 g/mol |
| Exact Mass | 601.22 |
| IUPAC Name | [2-[5-[2-fluoro-4-[(5S)-5-[(methoxycarbothioylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]-1,2,5-triazepan-1-yl]-2-oxoethyl] 2-[2-(2-methoxyethoxy)ethoxy]acetate |
| SMILES | COCCOCCOCC(=O)OCC(=O)N1CCN(c2ccc(N3C[C@H](CNC(=S)OC)OC3=O)cc2F)CCN1 |
| InChI | InChI=1S/C25H36FN5O9S/c1-35-9-10-37-11-12-38-17-23(33)39-16-22(32)31-8-7-29(6-5-28-31)21-4-3-18(13-20(21)26)30-15-19(40-25(30)34)14-27-24(41)36-2/h3-4,13,19,28H,5-12,14-17H2,1-2H3,(H,27,41)/t19-/m0/s1 |
| InChIKey | UJBWSPYBQHSSRB-IBGZPJMESA-N |
| XLogP | 0.05 |
| TPSA | 140.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.65 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|