C23H29FN8O4S — CID 74434928
O-methyl N-[[3-[3-fluoro-4-[1-(2-pyrazin-2-ylethylcarbamoyl)-1,2,5-triazepan-5-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamothioate (PubChem CID 74434928) has the molecular formula C23H29FN8O4S and a molecular weight of 532.60 g/mol. Its IUPAC name is O-methyl N-[[3-[3-fluoro-4-[1-(2-pyrazin-2-ylethylcarbamoyl)-1,2,5-triazepan-5-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamothioate.
| Compound Name | O-methyl N-[[3-[3-fluoro-4-[1-(2-pyrazin-2-ylethylcarbamoyl)-1,2,5-triazepan-5-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamothioate |
|---|---|
| PubChem CID | 74434928 |
| Molecular Formula | C23H29FN8O4S |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | O-methyl N-[[3-[3-fluoro-4-[1-(2-pyrazin-2-ylethylcarbamoyl)-1,2,5-triazepan-5-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamothioate |
| SMILES | COC(=S)NCC1CN(c2ccc(N3CCNN(C(=O)NCCc4cnccn4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C23H29FN8O4S/c1-35-22(37)28-14-18-15-31(23(34)36-18)17-2-3-20(19(24)12-17)30-9-8-29-32(11-10-30)21(33)27-5-4-16-13-25-6-7-26-16/h2-3,6-7,12-13,18,29H,4-5,8-11,14-15H2,1H3,(H,27,33)(H,28,37) |
| InChIKey | XMVHIJDGOOHVQA-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 124.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|