C20H29F2N5O4S — CID 159929511
methane;O-methyl N-[[(5S)-3-[3,5-difluoro-4-(1-propanoyl-1,2,5-triazepan-5-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamothioate (PubChem CID 159929511) has the molecular formula C20H29F2N5O4S and a molecular weight of 473.55 g/mol. Its IUPAC name is methane;O-methyl N-[[(5S)-3-[3,5-difluoro-4-(1-propanoyl-1,2,5-triazepan-5-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamothioate.
| Compound Name | methane;O-methyl N-[[(5S)-3-[3,5-difluoro-4-(1-propanoyl-1,2,5-triazepan-5-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamothioate |
|---|---|
| PubChem CID | 159929511 |
| Molecular Formula | C20H29F2N5O4S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | methane;O-methyl N-[[(5S)-3-[3,5-difluoro-4-(1-propanoyl-1,2,5-triazepan-5-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamothioate |
| SMILES | C.CCC(=O)N1CCN(c2c(F)cc(N3C[C@H](CNC(=S)OC)OC3=O)cc2F)CCN1 |
| InChI | InChI=1S/C19H25F2N5O4S.CH4/c1-3-16(27)26-7-6-24(5-4-23-26)17-14(20)8-12(9-15(17)21)25-11-13(30-19(25)28)10-22-18(31)29-2;/h8-9,13,23H,3-7,10-11H2,1-2H3,(H,22,31);1H4/t13-;/m0./s1 |
| InChIKey | NZLOXFKWGGODRY-ZOWNYOTGSA-N |
| XLogP | 2.01 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|