C24H23F4N5O6 — CID 76698929
4-[5-[4-[5-[[(2,2-difluoroacetyl)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2,6-difluorophenyl]-1,2,5-triazepane-1-carbonyl]benzoic acid (PubChem CID 76698929) has the molecular formula C24H23F4N5O6 and a molecular weight of 553.47 g/mol. Its IUPAC name is 4-[5-[4-[5-[[(2,2-difluoroacetyl)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2,6-difluorophenyl]-1,2,5-triazepane-1-carbonyl]benzoic acid.
| Compound Name | 4-[5-[4-[5-[[(2,2-difluoroacetyl)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2,6-difluorophenyl]-1,2,5-triazepane-1-carbonyl]benzoic acid |
|---|---|
| PubChem CID | 76698929 |
| Molecular Formula | C24H23F4N5O6 |
| Molecular Weight | 553.47 g/mol |
| Exact Mass | 553.16 |
| IUPAC Name | 4-[5-[4-[5-[[(2,2-difluoroacetyl)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2,6-difluorophenyl]-1,2,5-triazepane-1-carbonyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C(=O)N2CCN(c3c(F)cc(N4CC(CNC(=O)C(F)F)OC4=O)cc3F)CCN2)cc1 |
| InChI | InChI=1S/C24H23F4N5O6/c25-17-9-15(32-12-16(39-24(32)38)11-29-21(34)20(27)28)10-18(26)19(17)31-6-5-30-33(8-7-31)22(35)13-1-3-14(4-2-13)23(36)37/h1-4,9-10,16,20,30H,5-8,11-12H2,(H,29,34)(H,36,37) |
| InChIKey | FLOYSZSMDUWTAO-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.47 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|