C19H28F2N6O4S — CID 158038050
methane;O-methyl N-[[(5S)-3-[4-[1-(2-aminoacetyl)-1,2,5-triazepan-5-yl]-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamothioate (PubChem CID 158038050) has the molecular formula C19H28F2N6O4S and a molecular weight of 474.53 g/mol. Its IUPAC name is methane;O-methyl N-[[(5S)-3-[4-[1-(2-aminoacetyl)-1,2,5-triazepan-5-yl]-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamothioate.
| Compound Name | methane;O-methyl N-[[(5S)-3-[4-[1-(2-aminoacetyl)-1,2,5-triazepan-5-yl]-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamothioate |
|---|---|
| PubChem CID | 158038050 |
| Molecular Formula | C19H28F2N6O4S |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | methane;O-methyl N-[[(5S)-3-[4-[1-(2-aminoacetyl)-1,2,5-triazepan-5-yl]-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamothioate |
| SMILES | C.COC(=S)NC[C@H]1CN(c2cc(F)c(N3CCNN(C(=O)CN)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C18H24F2N6O4S.CH4/c1-29-17(31)22-9-12-10-25(18(28)30-12)11-6-13(19)16(14(20)7-11)24-3-2-23-26(5-4-24)15(27)8-21;/h6-7,12,23H,2-5,8-10,21H2,1H3,(H,22,31);1H4/t12-;/m0./s1 |
| InChIKey | FHZVRGKMYBVWSC-YDALLXLXSA-N |
| XLogP | 0.56 |
| TPSA | 112.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|