C17H21ClF2N4O5S2 — CID 57479688
O-methyl N-[[3-[4-[4-(chloromethylsulfonyl)piperazin-1-yl]-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamothioate (PubChem CID 57479688) has the molecular formula C17H21ClF2N4O5S2 and a molecular weight of 498.96 g/mol. Its IUPAC name is O-methyl N-[[3-[4-[4-(chloromethylsulfonyl)piperazin-1-yl]-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamothioate.
| Compound Name | O-methyl N-[[3-[4-[4-(chloromethylsulfonyl)piperazin-1-yl]-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamothioate |
|---|---|
| PubChem CID | 57479688 |
| Molecular Formula | C17H21ClF2N4O5S2 |
| Molecular Weight | 498.96 g/mol |
| Exact Mass | 498.06 |
| IUPAC Name | O-methyl N-[[3-[4-[4-(chloromethylsulfonyl)piperazin-1-yl]-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamothioate |
| SMILES | COC(=S)NCC1CN(c2cc(F)c(N3CCN(S(=O)(=O)CCl)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C17H21ClF2N4O5S2/c1-28-16(30)21-8-12-9-24(17(25)29-12)11-6-13(19)15(14(20)7-11)22-2-4-23(5-3-22)31(26,27)10-18/h6-7,12H,2-5,8-10H2,1H3,(H,21,30) |
| InChIKey | CCGHSNJREMCYFS-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.96 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|