C20H26F2N4O3S — CID 18619390
N-[[3-[4-(4-acetylpiperazin-1-yl)-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-methylpropanethioamide (PubChem CID 18619390) has the molecular formula C20H26F2N4O3S and a molecular weight of 440.52 g/mol. Its IUPAC name is N-[[3-[4-(4-acetylpiperazin-1-yl)-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-methylpropanethioamide.
| Compound Name | N-[[3-[4-(4-acetylpiperazin-1-yl)-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-methylpropanethioamide |
|---|---|
| PubChem CID | 18619390 |
| Molecular Formula | C20H26F2N4O3S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | N-[[3-[4-(4-acetylpiperazin-1-yl)-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-methylpropanethioamide |
| SMILES | CC(=O)N1CCN(c2c(F)cc(N3CC(CNC(=S)C(C)C)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C20H26F2N4O3S/c1-12(2)19(30)23-10-15-11-26(20(28)29-15)14-8-16(21)18(17(22)9-14)25-6-4-24(5-7-25)13(3)27/h8-9,12,15H,4-7,10-11H2,1-3H3,(H,23,30) |
| InChIKey | PLNIUJZRRZEGHA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|